ChemNet > CAS > 3377-87-5 3-bromohexane
3377-87-5 3-bromohexane
| Produkt-Name |
3-bromohexane |
| Synonyme |
Hexane, 3-bromo- |
| Molekulare Formel |
C6H13Br |
| Molecular Weight |
165.0714 |
| InChI |
InChI=1/C6H13Br/c1-3-5-6(7)4-2/h6H,3-5H2,1-2H3 |
| CAS Registry Number |
3377-87-5 |
| EINECS |
222-174-9 |
| Molecular Structure |
|
| Dichte |
1.169g/cm3 |
| Siedepunkt |
144°C at 760 mmHg |
| Brechungsindex |
1.444 |
| Flammpunkt |
40.1°C |
| Gefahrensymbole |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
