ChemNet > CAS > 33775-94-9 2-Iodothioanisole
33775-94-9 2-Iodothioanisole
| Produkt-Name |
2-Iodothioanisole |
| Synonyme |
2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene; 1-Iodo-2-(methylthio)benzene; 1-iodo-2-(methylsulfanyl)benzene |
| Molekulare Formel |
C7H7IS |
| Molecular Weight |
250.0999 |
| InChI |
InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| CAS Registry Number |
33775-94-9 |
| Molecular Structure |
|
| Dichte |
1.78g/cm3 |
| Siedepunkt |
253°C at 760 mmHg |
| Brechungsindex |
1.67 |
| Flammpunkt |
106.8°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
