ChemNet > CAS > 34145-05-6;5402-73-7 2,5-Dichlorobenzyl alcohol
34145-05-6;5402-73-7 2,5-Dichlorobenzyl alcohol
Produkt-Name |
2,5-Dichlorobenzyl alcohol |
Synonyme |
2,5-Dichlorobenzylic alcohol; (2,5-dichlorophenyl)methanol |
Molekulare Formel |
C7H6Cl2O |
Molecular Weight |
177.0279 |
InChI |
InChI=1/C7H6Cl2O/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2 |
CAS Registry Number |
34145-05-6;5402-73-7 |
EINECS |
251-850-6 |
Molecular Structure |
|
Dichte |
1.392g/cm3 |
Schmelzpunkt |
77-80℃ |
Siedepunkt |
265.7°C at 760 mmHg |
Brechungsindex |
1.582 |
Flammpunkt |
114.3°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|