ChemNet > CAS > 347-55-7 2-(trifluoromethylthio)aniline
347-55-7 2-(trifluoromethylthio)aniline
| Produkt-Name |
2-(trifluoromethylthio)aniline |
| Synonyme |
2-Aminophenyl trifluoromethyl sulphide; 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
| Molekulare Formel |
C11H11FO4 |
| Molecular Weight |
226.201 |
| InChI |
InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
| CAS Registry Number |
347-55-7 |
| EINECS |
206-473-1 |
| Molecular Structure |
|
| Dichte |
1.279g/cm3 |
| Siedepunkt |
422.6°C at 760 mmHg |
| Brechungsindex |
1.52 |
| Flammpunkt |
209.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
