ChemNet > CAS > 352018-92-9 5-iodo-2-phenoxypyridine
352018-92-9 5-iodo-2-phenoxypyridine
| Produkt-Name |
5-iodo-2-phenoxypyridine |
| Molekulare Formel |
C11H8INO |
| Molecular Weight |
297.0918 |
| InChI |
InChI=1/C11H8INO/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H |
| CAS Registry Number |
352018-92-9 |
| Molecular Structure |
|
| Dichte |
1.694g/cm3 |
| Siedepunkt |
339.8°C at 760 mmHg |
| Brechungsindex |
1.646 |
| Flammpunkt |
159.3°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
