ChemNet > CAS > 3644-56-2 2-Chloro-N-(2,6-dichlorophenyl)-acetamide
3644-56-2 2-Chloro-N-(2,6-dichlorophenyl)-acetamide
| Produkt-Name |
2-Chloro-N-(2,6-dichlorophenyl)-acetamide |
| Synonyme |
2-Chloro-N-(2,6-dichlorophenyl)acetamide |
| Molekulare Formel |
C8H6Cl3NO |
| Molecular Weight |
238.4983 |
| InChI |
InChI=1/C8H6Cl3NO/c9-4-7(13)12-8-5(10)2-1-3-6(8)11/h1-3H,4H2,(H,12,13) |
| CAS Registry Number |
3644-56-2 |
| EINECS |
222-874-4 |
| Molecular Structure |
|
| Dichte |
1.511g/cm3 |
| Schmelzpunkt |
176-179℃ |
| Siedepunkt |
376.2°C at 760 mmHg |
| Brechungsindex |
1.616 |
| Flammpunkt |
181.3°C |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
