ChemNet > CAS > 3696-22-8 1-(4-nitrophenyl)-2-thiourea
3696-22-8 1-(4-nitrophenyl)-2-thiourea
Produkt-Name |
1-(4-nitrophenyl)-2-thiourea |
Synonyme |
4-Nitrophenylthiourea; 1-(4-nitrophenyl)thiourea |
Molekulare Formel |
C7H7N3O2S |
Molecular Weight |
197.2144 |
InChI |
InChI=1/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13) |
CAS Registry Number |
3696-22-8 |
EINECS |
223-021-9 |
Molecular Structure |
|
Dichte |
1.524g/cm3 |
Schmelzpunkt |
206℃ |
Siedepunkt |
365.5°C at 760 mmHg |
Brechungsindex |
1.759 |
Flammpunkt |
174.9°C |
Gefahrensymbole |
|
Risk Codes |
R25:Toxic if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|