ChemNet > CAS > 37107-50-9 Cyclohexylidenecyanoacetic acid
37107-50-9 Cyclohexylidenecyanoacetic acid
Produkt-Name |
Cyclohexylidenecyanoacetic acid |
Synonyme |
Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid |
Molekulare Formel |
C9H11NO2 |
Molecular Weight |
165.1891 |
InChI |
InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
CAS Registry Number |
37107-50-9 |
EINECS |
253-351-9 |
Molecular Structure |
|
Dichte |
1.211g/cm3 |
Siedepunkt |
353.9°C at 760 mmHg |
Brechungsindex |
1.537 |
Flammpunkt |
167.8°C |
Gefahrensymbole |
|
Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|