ChemNet > CAS > 394-29-6 5-Chloro-2-fluorobenzoyl chloride
394-29-6 5-Chloro-2-fluorobenzoyl chloride
Produkt-Name |
5-Chloro-2-fluorobenzoyl chloride |
Synonyme |
5-Chloro-2-fluorobenzyl chloride; 2-Fluoro-5-Chorobenzoyl Chloride |
Molekulare Formel |
C7H3Cl2FO |
Molecular Weight |
193.0025 |
InChI |
InChI=1/C7H3Cl2FO/c8-4-1-2-6(10)5(3-4)7(9)11/h1-3H |
CAS Registry Number |
394-29-6 |
Molecular Structure |
|
Dichte |
1.462g/cm3 |
Siedepunkt |
213°C at 760 mmHg |
Brechungsindex |
1.539 |
Flammpunkt |
82.6°C |
Gefahrensymbole |
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|