ChemNet > CAS > 41513-04-6 1-Bromo-4-chloro-2-nitrobenzene
41513-04-6 1-Bromo-4-chloro-2-nitrobenzene
| Produkt-Name |
1-Bromo-4-chloro-2-nitrobenzene |
| Synonyme |
2-Bromo-5-chloronitrobenzene |
| Molekulare Formel |
C6H3BrClNO2 |
| Molecular Weight |
236.4505 |
| InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| CAS Registry Number |
41513-04-6 |
| EINECS |
255-421-4 |
| Molecular Structure |
|
| Dichte |
1.827g/cm3 |
| Schmelzpunkt |
67-70℃ |
| Siedepunkt |
242.5°C at 760 mmHg |
| Brechungsindex |
1.618 |
| Flammpunkt |
100.5°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
