ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
Produkt-Name |
2-Chloro-6-iodotoluene |
Synonyme |
1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
Molekulare Formel |
C7H6ClI |
Molecular Weight |
252.48 |
InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
CAS Registry Number |
42048-11-3 |
Molecular Structure |
|
Dichte |
1.806g/cm3 |
Siedepunkt |
243°C at 760 mmHg |
Brechungsindex |
1.616 |
Flammpunkt |
100.8°C |
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|