ChemNet > CAS > 4295-06-1 4-Chloroquinaldine
4295-06-1 4-Chloroquinaldine
| Produkt-Name |
4-Chloroquinaldine |
| Synonyme |
4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
| Molekulare Formel |
C10H8ClN |
| Molecular Weight |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| CAS Registry Number |
4295-06-1 |
| EINECS |
224-300-8 |
| Molecular Structure |
|
| Dichte |
1.225g/cm3 |
| Schmelzpunkt |
39-270℃ |
| Siedepunkt |
269.5°C at 760 mmHg |
| Brechungsindex |
1.634 |
| Flammpunkt |
140.2°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
