ChemNet > CAS > 447-53-0 1,2-Dihydronaphthalene
447-53-0 1,2-Dihydronaphthalene
Produkt-Name |
1,2-Dihydronaphthalene |
Synonyme |
1,2-DIHYDRONAPHTHALENE; naphthalene, 1,2-dihydro- |
Molekulare Formel |
C10H10 |
Molecular Weight |
130.1864 |
InChI |
InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
CAS Registry Number |
447-53-0 |
EINECS |
207-183-8 |
Molecular Structure |
|
Dichte |
1.004g/cm3 |
Schmelzpunkt |
-8℃ |
Siedepunkt |
204.9°C at 760 mmHg |
Brechungsindex |
1.572 |
Flammpunkt |
70.4°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|