ChemNet > CAS > 459-47-2 1,4-ethylfluorobenzene
459-47-2 1,4-ethylfluorobenzene
| Produkt-Name |
1,4-ethylfluorobenzene |
| Synonyme |
1-Ethyl-4-fluorobenzene; benzene, 1-ethyl-4-fluoro-; Ethyl-4-fluorobenzene |
| Molekulare Formel |
C8H9F |
| Molecular Weight |
124.1555 |
| InChI |
InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
| CAS Registry Number |
459-47-2 |
| Molecular Structure |
|
| Dichte |
0.981g/cm3 |
| Siedepunkt |
141.6°C at 760 mmHg |
| Brechungsindex |
1.477 |
| Flammpunkt |
28.9°C |
| Gefahrensymbole |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
