ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| Produkt-Name |
2-aminothiophene-3-carbonitrile |
| Synonyme |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| Molekulare Formel |
C5H4N2S |
| Molecular Weight |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| CAS Registry Number |
4651-82-5 |
| Molecular Structure |
|
| Dichte |
1.33g/cm3 |
| Schmelzpunkt |
104℃ |
| Siedepunkt |
317.5°C at 760 mmHg |
| Brechungsindex |
1.627 |
| Flammpunkt |
145.8°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
