ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
| Produkt-Name |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
| Synonyme |
5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
| Molekulare Formel |
C11H15NO4S |
| Molecular Weight |
257.3061 |
| InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
| CAS Registry Number |
4815-30-9 |
| EINECS |
225-388-0 |
| Molecular Structure |
|
| Dichte |
1.247g/cm3 |
| Schmelzpunkt |
103-108℃ |
| Siedepunkt |
372.6°C at 760 mmHg |
| Brechungsindex |
1.558 |
| Flammpunkt |
179.1°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
