ChemNet > CAS > 4819-77-6 Triethoxyethane
4819-77-6 Triethoxyethane
| Produkt-Name |
Triethoxyethane |
| Synonyme |
1,1,2-Triethoxyethane; Ethoxyacetaldehyde diethyl acetal |
| Molekulare Formel |
C8H18O3 |
| Molecular Weight |
162.2267 |
| InChI |
InChI=1/C8H18O3/c1-4-9-7-8(10-5-2)11-6-3/h8H,4-7H2,1-3H3 |
| CAS Registry Number |
4819-77-6 |
| EINECS |
225-394-3 |
| Molecular Structure |
|
| Dichte |
0.901g/cm3 |
| Siedepunkt |
180.9°C at 760 mmHg |
| Brechungsindex |
1.406 |
| Flammpunkt |
59.6°C |
| Gefahrensymbole |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
