ChemNet > CAS > 491-78-1 Primuletin
491-78-1 Primuletin
| Produkt-Name |
Primuletin |
| Synonyme |
5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
| Molekulare Formel |
C15H10O3 |
| Molecular Weight |
238.2381 |
| InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| CAS Registry Number |
491-78-1 |
| EINECS |
207-743-1 |
| Molecular Structure |
|
| Dichte |
1.34g/cm3 |
| Siedepunkt |
425°C at 760 mmHg |
| Brechungsindex |
1.666 |
| Flammpunkt |
165.4°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
