ChemNet > CAS > 4964-71-0 5-Bromo-quinoline
4964-71-0 5-Bromo-quinoline
| Produkt-Name |
5-Bromo-quinoline |
| Synonyme |
5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
| Molekulare Formel |
C9H6BrN |
| Molecular Weight |
208.0546 |
| InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| CAS Registry Number |
4964-71-0 |
| Molecular Structure |
|
| Dichte |
1.564g/cm3 |
| Siedepunkt |
295.9°C at 760 mmHg |
| Brechungsindex |
1.673 |
| Flammpunkt |
132.8°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
