ChemNet > CAS > 4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
| Produkt-Name |
4-Hydroxy-6-methyl-3-nitro-2-pyridone |
| Synonyme |
2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
| Molekulare Formel |
C6H6N2O4 |
| Molecular Weight |
170.1228 |
| InChI |
InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
| CAS Registry Number |
4966-90-9 |
| Molecular Structure |
|
| Dichte |
1.53g/cm3 |
| Schmelzpunkt |
293-296℃ |
| Siedepunkt |
265.6°C at 760 mmHg |
| Brechungsindex |
1.608 |
| Flammpunkt |
114.4°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
