ChemNet > CAS > 50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
| Produkt-Name |
(2,4-dimethyl-1,3-thiazol-5-yl)methanol |
| Synonyme |
(2,4-dimethylthiazol-5-yl)methanol;
|
| Molekulare Formel |
C6H9NOS |
| Molecular Weight |
143.2068 |
| InChI |
InChI=1/C6H9NOS/c1-4-6(3-8)9-5(2)7-4/h8H,3H2,1-2H3 |
| CAS Registry Number |
50382-32-6 |
| Molecular Structure |
|
| Dichte |
1.208g/cm3 |
| Schmelzpunkt |
46℃ |
| Siedepunkt |
261.965°C at 760 mmHg |
| Brechungsindex |
1.569 |
| Flammpunkt |
112.233°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
