ChemNet > CAS > 51067-38-0 4-Phenoxyphenyl boronic acid
51067-38-0 4-Phenoxyphenyl boronic acid
| Produkt-Name |
4-Phenoxyphenyl boronic acid |
| Synonyme |
4-Phenoxybenzene boronic acid;
|
| Molekulare Formel |
C12H11BO3 |
| Molecular Weight |
214.0249 |
| InChI |
InChI=1/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H |
| CAS Registry Number |
51067-38-0 |
| Molecular Structure |
|
| Dichte |
1.23g/cm3 |
| Schmelzpunkt |
141-145℃ |
| Siedepunkt |
377°C at 760 mmHg |
| Brechungsindex |
1.605 |
| Flammpunkt |
181.8°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
