ChemNet > CAS > 5142-22-3 1-Methyladenine
5142-22-3 1-Methyladenine
| Produkt-Name |
1-Methyladenine |
| Synonyme |
6H-Purin-6-imine, 1,9-dihydro-1-methyl-; Adenine, 1-methyl-; NSC 70896; 1-Methyl-1H-purin-6-amine; 1H-Purin-6-amine, 1-methyl- (9CI); 1-methyl-1,7-dihydro-6H-purin-6-imine |
| Molekulare Formel |
C6H7N5 |
| Molecular Weight |
149.1533 |
| InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(5(11)7)8-2-9-6/h2-3,7H,1H3,(H,8,9) |
| CAS Registry Number |
5142-22-3 |
| EINECS |
225-907-0 |
| Molecular Structure |
|
| Dichte |
1.607g/cm3 |
| Schmelzpunkt |
300℃ |
| Siedepunkt |
415.879°C at 760 mmHg |
| Brechungsindex |
1.807 |
| Flammpunkt |
205.317°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
