ChemNet > CAS > 22135-50-8;52244-70-9 4-(4-methoxyphenyl)-1-butanol
22135-50-8;52244-70-9 4-(4-methoxyphenyl)-1-butanol
Produkt-Name |
4-(4-methoxyphenyl)-1-butanol |
Synonyme |
4-(4-methoxyphenyl)butan-1-ol; 1-(4-methoxyphenyl)butan-1-ol |
Molekulare Formel |
C11H16O2 |
Molecular Weight |
180.2435 |
InChI |
InChI=1/C11H16O2/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8,12H,2-4,9H2,1H3 |
CAS Registry Number |
22135-50-8;52244-70-9 |
EINECS |
257-782-3 |
Molecular Structure |
|
Dichte |
1.019g/cm3 |
Schmelzpunkt |
3-4℃ |
Siedepunkt |
304.7°C at 760 mmHg |
Brechungsindex |
1.514 |
Flammpunkt |
130.9°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|