ChemNet > CAS > 524-95-8 Diphenylborinic acid 2-aminoethyl ester
524-95-8 Diphenylborinic acid 2-aminoethyl ester
| Produkt-Name |
Diphenylborinic acid 2-aminoethyl ester |
| Synonyme |
2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
| Molekulare Formel |
C14H16BNO |
| Molecular Weight |
225.0939 |
| InChI |
InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| CAS Registry Number |
524-95-8 |
| EINECS |
208-366-5 |
| Molecular Structure |
|
| Dichte |
1.04g/cm3 |
| Schmelzpunkt |
190-194℃ |
| Siedepunkt |
325.3°C at 760 mmHg |
| Brechungsindex |
1.559 |
| Flammpunkt |
150.6°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
