Produkt-Name |
Gluconic acid |
Synonyme |
D-Gluconic acid solution; Gluconicacidaqsoln; D-Gluconic acid; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (non-preferred name); Gluconic Acid Solution |
Molekulare Formel |
C6H11O7 |
Molecular Weight |
195.1479 |
InChI |
InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1 |
CAS Registry Number |
526-95-4 |
EINECS |
208-401-4 |
Molecular Structure |
|
Schmelzpunkt |
15℃ |
Siedepunkt |
673.6°C at 760 mmHg |
Flammpunkt |
375.1°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|