ChemNet > CAS > 527-21-9 Tetrafluoro-p-benzoquinone
527-21-9 Tetrafluoro-p-benzoquinone
Produkt-Name |
Tetrafluoro-p-benzoquinone |
Synonyme |
Tetrafluoro-p-benzoquinone~Tetrafluoro-1,4-benzoquinone; p-Fluoranil; 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione |
Molekulare Formel |
C6F4O2 |
Molecular Weight |
180.0566 |
InChI |
InChI=1/C6F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
CAS Registry Number |
527-21-9 |
EINECS |
208-411-9 |
Molecular Structure |
|
Dichte |
1.62g/cm3 |
Schmelzpunkt |
183-186℃ |
Siedepunkt |
133.1°C at 760 mmHg |
Brechungsindex |
1.409 |
Flammpunkt |
44.6°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S37:Wear suitable gloves.;
|
|