ChemNet > CAS > 529-84-0 4-Methylesculetin
529-84-0 4-Methylesculetin
| Produkt-Name |
4-Methylesculetin |
| Synonyme |
6,7-Dihydroxy-4-methylcoumarin; 4-Methylesculetin, (6,7-Dihydroxy-4-methylcoumarin); 4-methylaesculetin; 6,7-dihydroxy-4-methyl-2H-chromen-2-one |
| Molekulare Formel |
C10H8O4 |
| Molecular Weight |
192.1681 |
| InChI |
InChI=1/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3 |
| CAS Registry Number |
529-84-0 |
| EINECS |
208-470-0 |
| Molecular Structure |
|
| Dichte |
1.456g/cm3 |
| Schmelzpunkt |
274-276℃ |
| Siedepunkt |
455.5°C at 760 mmHg |
| Brechungsindex |
1.651 |
| Flammpunkt |
190.7°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
