ChemNet > CAS > 5306-96-7 2,3-Dimethyl-p-phenylenediamine
5306-96-7 2,3-Dimethyl-p-phenylenediamine
Produkt-Name |
2,3-Dimethyl-p-phenylenediamine |
Synonyme |
p-Phenylenediamine, 2,3-dimethyl-; 4-Amino-5,6-dimethylaniline; CCRIS 8132; 2,3-dimethylbenzene-1,4-diamine; 1,4-Diamino-2,3-dimethylbenzene |
Molekulare Formel |
C8H12N2 |
Molecular Weight |
136.1943 |
InChI |
InChI=1/C8H12N2/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,9-10H2,1-2H3 |
CAS Registry Number |
5306-96-7 |
Molecular Structure |
|
Dichte |
1.076g/cm3 |
Siedepunkt |
288.5°C at 760 mmHg |
Brechungsindex |
1.618 |
Flammpunkt |
151.5°C |
Gefahrensymbole |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|