ChemNet > CAS > 5422-88-8 Cyclopentyl phenyl ketone
5422-88-8 Cyclopentyl phenyl ketone
| Produkt-Name |
Cyclopentyl phenyl ketone |
| Synonyme |
Benzoylcyclopentane; cyclopentyl(phenyl)methanone |
| Molekulare Formel |
C12H14O |
| Molecular Weight |
174.239 |
| InChI |
InChI=1/C12H14O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
| CAS Registry Number |
5422-88-8 |
| EINECS |
226-548-2 |
| Molecular Structure |
|
| Dichte |
1.051g/cm3 |
| Siedepunkt |
273.9°C at 760 mmHg |
| Brechungsindex |
1.548 |
| Flammpunkt |
112.4°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
