ChemNet > CAS > 55708-65-1 4-Benzyloxy-3-methoxystyrene
55708-65-1 4-Benzyloxy-3-methoxystyrene
| Produkt-Name |
4-Benzyloxy-3-methoxystyrene |
| Synonyme |
2-benzyloxy-5-vinylanisole; 1-(benzyloxy)-4-ethenyl-2-methoxybenzene |
| Molekulare Formel |
C16H16O2 |
| Molecular Weight |
240.297 |
| InChI |
InChI=1/C16H16O2/c1-3-13-9-10-15(16(11-13)17-2)18-12-14-7-5-4-6-8-14/h3-11H,1,12H2,2H3 |
| CAS Registry Number |
55708-65-1 |
| EINECS |
259-771-9 |
| Molecular Structure |
|
| Dichte |
1.072g/cm3 |
| Schmelzpunkt |
48-55℃ |
| Siedepunkt |
371.3°C at 760 mmHg |
| Brechungsindex |
1.584 |
| Flammpunkt |
147.6°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
