ChemNet > CAS > 58161-35-6 N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide
58161-35-6 N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide
| Produkt-Name |
N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide |
| Synonyme |
5-(Acetylamino)-1-indanone; 5-Acetamido-1-indanone; 5-Acetylamino-1-indanone; N-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide |
| Molekulare Formel |
C11H11NO2 |
| Molecular Weight |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-7(13)12-9-3-4-10-8(6-9)2-5-11(10)14/h3-4,6H,2,5H2,1H3,(H,12,13) |
| CAS Registry Number |
58161-35-6 |
| Molecular Structure |
|
| Dichte |
1.278g/cm3 |
| Schmelzpunkt |
169℃ |
| Siedepunkt |
427.362°C at 760 mmHg |
| Brechungsindex |
1.632 |
| Flammpunkt |
194.835°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
