ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| Produkt-Name |
4-(difluoromethoxy)bromobenzene |
| Synonyme |
1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| Molekulare Formel |
C7H5BrF2O |
| Molecular Weight |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| CAS Registry Number |
5905-69-1 |
| Molecular Structure |
|
| Dichte |
1.583g/cm3 |
| Siedepunkt |
205.406°C at 760 mmHg |
| Brechungsindex |
1.492 |
| Flammpunkt |
92.591°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
