ChemNet > CAS > 59108-13-3 5,7-dichloro-4-hydroxy-2-(trifluoromethyl)quinoline
59108-13-3 5,7-dichloro-4-hydroxy-2-(trifluoromethyl)quinoline
Produkt-Name |
5,7-dichloro-4-hydroxy-2-(trifluoromethyl)quinoline |
Synonyme |
5,7-Dichloro-2-(trifluoromethyl)quinolin-4-ol; 5,7-dichloro-2-(trifluoromethyl)quinolin-4(1H)-one |
Molekulare Formel |
C7H4BrFO |
Molecular Weight |
203.0085 |
InChI |
InChI=1/C7H4BrFO/c8-7-3-6(9)2-1-5(7)4-10/h1-4H |
CAS Registry Number |
59108-13-3 |
Molecular Structure |
|
Dichte |
1.67g/cm3 |
Schmelzpunkt |
230℃ |
Siedepunkt |
234.9°C at 760 mmHg |
Brechungsindex |
1.584 |
Flammpunkt |
95.9°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|