ChemNet > CAS > 623-76-7 1,3-diethylurea
623-76-7 1,3-diethylurea
| Produkt-Name |
1,3-diethylurea |
| Synonyme |
N,N-Diethylurea; Diethylurea symmetrical; N,N'-Diethylurea |
| Molekulare Formel |
C5H12N2O |
| Molecular Weight |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
| CAS Registry Number |
623-76-7 |
| EINECS |
210-811-3 |
| Molecular Structure |
|
| Dichte |
0.923g/cm3 |
| Schmelzpunkt |
112-113℃ |
| Siedepunkt |
263°C at 760 mmHg |
| Brechungsindex |
1.428 |
| Flammpunkt |
121.1°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
