ChemNet > CAS > 625-77-4 Diacetamide
625-77-4 Diacetamide
| Produkt-Name |
Diacetamide |
| Synonyme |
diacetylamine; N-acetylacetamide |
| Molekulare Formel |
C4H7NO2 |
| Molecular Weight |
101.1039 |
| InChI |
InChI=1/C4H7NO2/c1-3(6)5-4(2)7/h1-2H3,(H,5,6,7) |
| CAS Registry Number |
625-77-4 |
| EINECS |
210-910-1 |
| Molecular Structure |
|
| Dichte |
1.035g/cm3 |
| Schmelzpunkt |
74-78℃ |
| Siedepunkt |
223.5°C at 760 mmHg |
| Brechungsindex |
1.41 |
| Flammpunkt |
101.8°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
