ChemNet > CAS > 6276-04-6 1-iodo-3,5-dinitrobenzene
6276-04-6 1-iodo-3,5-dinitrobenzene
| Produkt-Name |
1-iodo-3,5-dinitrobenzene |
| Molekulare Formel |
C6H3IN2O4 |
| Molecular Weight |
294.0035 |
| InChI |
InChI=1/C6H3IN2O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H |
| CAS Registry Number |
6276-04-6 |
| Molecular Structure |
|
| Dichte |
2.174g/cm3 |
| Schmelzpunkt |
108-111℃ |
| Siedepunkt |
346°C at 760 mmHg |
| Brechungsindex |
1.699 |
| Flammpunkt |
163.1°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R42/43:May cause sensitization by inhalation and skin contact.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
|
|
