ChemNet > CAS > 628-99-9 2-Nonanol
628-99-9 2-Nonanol
| Produkt-Name |
2-Nonanol |
| Synonyme |
n-Heptyl methyl carbinol; nonan-2-ol |
| Molekulare Formel |
C9H20O |
| Molecular Weight |
144.2545 |
| InChI |
InChI=1/C9H20O/c1-3-4-5-6-7-8-9(2)10/h9-10H,3-8H2,1-2H3 |
| CAS Registry Number |
628-99-9 |
| EINECS |
211-065-1 |
| Molecular Structure |
|
| Dichte |
0.824g/cm3 |
| Schmelzpunkt |
-36℃ |
| Siedepunkt |
195.5°C at 760 mmHg |
| Brechungsindex |
1.43 |
| Flammpunkt |
82.2°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
