ChemNet > CAS > 6326-44-9 Diethyl formamidomalonate
6326-44-9 Diethyl formamidomalonate
| Produkt-Name |
Diethyl formamidomalonate |
| Synonyme |
Formamidomalonic acid diethyl ester; diethyl (formylamino)propanedioate; Diethylformamidomalonate |
| Molekulare Formel |
C8H13NO5 |
| Molecular Weight |
203.1925 |
| InChI |
InChI=1/C8H13NO5/c1-3-13-7(11)6(9-5-10)8(12)14-4-2/h5-6H,3-4H2,1-2H3,(H,9,10) |
| CAS Registry Number |
6326-44-9 |
| EINECS |
228-692-1 |
| Molecular Structure |
|
| Dichte |
1.167g/cm3 |
| Schmelzpunkt |
51-56℃ |
| Siedepunkt |
316.8°C at 760 mmHg |
| Brechungsindex |
1.445 |
| Flammpunkt |
165.7°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
