ChemNet > CAS > 6326-83-6 Bis(carboxymethyl) trithiocarbonate
6326-83-6 Bis(carboxymethyl) trithiocarbonate
| Produkt-Name |
Bis(carboxymethyl) trithiocarbonate |
| Synonyme |
3,5-dithia-4-thioxo-1,7-heptanedioic acid; 2,2'-(carbonothioyldisulfanediyl)diacetic acid; 2,2'-(carbonothioyldisulfanediyl)diacetate |
| Molekulare Formel |
C5H4O4S3 |
| Molecular Weight |
224.279 |
| InChI |
InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
| CAS Registry Number |
6326-83-6 |
| EINECS |
228-693-7 |
| Molecular Structure |
|
| Schmelzpunkt |
170-175℃ |
| Siedepunkt |
532.5°C at 760 mmHg |
| Flammpunkt |
275.9°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
