CAS No: 638-17-5, Chemical Name: 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
the physical and chemical property of 638-17-5, 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine is provided by ChemNet.com
ChemNet > CAS > 638-17-5 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
638-17-5 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
| Produkt-Name |
5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine |
| Synonyme |
2,4,6-trimethyl-1,3,5-dithiazinane; 2,4,6-Trimethyl-1,3,5-dithiazine |
| Molekulare Formel |
C6H13NS2 |
| Molecular Weight |
163.3041 |
| InChI |
InChI=1/C6H13NS2/c1-4-7-5(2)9-6(3)8-4/h4-7H,1-3H3 |
| CAS Registry Number |
638-17-5 |
| EINECS |
211-323-3 |
| Molecular Structure |
|
| Dichte |
1.011g/cm3 |
| Siedepunkt |
260.7°C at 760 mmHg |
| Brechungsindex |
1.501 |
| Flammpunkt |
111.5°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
|
|
