ChemNet > CAS > 64-65-3 Bemegride
64-65-3 Bemegride
| Produkt-Name |
Bemegride |
| Synonyme |
3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
| Molekulare Formel |
C8H13NO2 |
| Molecular Weight |
155.1943 |
| InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| CAS Registry Number |
64-65-3 |
| EINECS |
200-588-0 |
| Molecular Structure |
|
| Dichte |
1.024g/cm3 |
| Schmelzpunkt |
126-129℃ |
| Siedepunkt |
282°C at 760 mmHg |
| Brechungsindex |
1.448 |
| Flammpunkt |
125.8°C |
| Gefahrensymbole |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
