ChemNet > CAS > 692-04-6 Nepsilon-Acetyl-L-lysine
692-04-6 Nepsilon-Acetyl-L-lysine
| Produkt-Name |
Nepsilon-Acetyl-L-lysine |
| Synonyme |
H-Lys(Ac)-OH・HCl; H-Lys(Ac)-OH; N-Epsilon-Acetyl-L-Lysine |
| Molekulare Formel |
C8H16N2O3 |
| Molecular Weight |
188.2242 |
| InChI |
InChI=1/C8H16N2O3/c1-6(11)10-5-3-2-4-7(9)8(12)13/h7H,2-5,9H2,1H3,(H,10,11)(H,12,13) |
| CAS Registry Number |
692-04-6 |
| EINECS |
211-725-9 |
| Molecular Structure |
|
| Dichte |
1.139g/cm3 |
| Schmelzpunkt |
250℃ |
| Siedepunkt |
442°C at 760 mmHg |
| Brechungsindex |
1.49 |
| Flammpunkt |
221.1°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
