ChemNet > CAS > 697-86-9 2-Bromo-4,6-dichloroaniline
697-86-9 2-Bromo-4,6-dichloroaniline
| Produkt-Name |
2-Bromo-4,6-dichloroaniline |
| Synonyme |
2-bromo-1-(4-cyclohexylphenyl)ethanone; Benzenamine, 2-bromo-4,6-dichloro- |
| Molekulare Formel |
C6H4BrCl2N |
| Molecular Weight |
240.9127 |
| InChI |
InChI=1/C6H4BrCl2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
| CAS Registry Number |
697-86-9 |
| Molecular Structure |
|
| Dichte |
1.827g/cm3 |
| Siedepunkt |
273°C at 760 mmHg |
| Brechungsindex |
1.648 |
| Flammpunkt |
121.8°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Safety Beschreibung |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
