ChemNet > CAS > 7145-99-5 3,4-(Methylenedioxy)toluene
7145-99-5 3,4-(Methylenedioxy)toluene
Produkt-Name |
3,4-(Methylenedioxy)toluene |
Synonyme |
5-Methyl-1,3-benzodioxole~1-Methyl-3,4-(methylenedioxy)benzene; 5-methyl-1,3-benzodioxole |
Molekulare Formel |
C8H8O2 |
Molecular Weight |
136.1479 |
InChI |
InChI=1/C8H8O2/c1-6-2-3-7-8(4-6)10-5-9-7/h2-4H,5H2,1H3 |
CAS Registry Number |
7145-99-5 |
EINECS |
230-453-1 |
Molecular Structure |
|
Dichte |
1.164g/cm3 |
Siedepunkt |
200.4°C at 760 mmHg |
Brechungsindex |
1.55 |
Flammpunkt |
76.1°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|