ChemNet > CAS > 72235-55-3 3-Chloro-2-fluorobenzylamine
72235-55-3 3-Chloro-2-fluorobenzylamine
| Produkt-Name |
3-Chloro-2-fluorobenzylamine |
| Synonyme |
1-(3-chloro-2-fluorophenyl)methanamine |
| Molekulare Formel |
C7H7ClFN |
| Molecular Weight |
159.5886 |
| InChI |
InChI=1/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| CAS Registry Number |
72235-55-3 |
| Molecular Structure |
|
| Dichte |
1.27g/cm3 |
| Siedepunkt |
219.6°C at 760 mmHg |
| Brechungsindex |
1.543 |
| Flammpunkt |
86.6°C |
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
