ChemNet > CAS > 72856-73-6 2-methoxy-4-(methylthio)benzoic acid
72856-73-6 2-methoxy-4-(methylthio)benzoic acid
Produkt-Name |
2-methoxy-4-(methylthio)benzoic acid |
Synonyme |
4-(Methylthio)-o-anisic acid; 2-methoxy-4-(methylsulfanyl)benzoic acid |
Molekulare Formel |
C9H10O3S |
Molecular Weight |
198.2389 |
InChI |
InChI=1/C9H10O3S/c1-12-8-5-6(13-2)3-4-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
CAS Registry Number |
72856-73-6 |
EINECS |
276-948-6 |
Molecular Structure |
|
Dichte |
1.29g/cm3 |
Siedepunkt |
342.3°C at 760 mmHg |
Brechungsindex |
1.592 |
Flammpunkt |
160.8°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|