ChemNet > CAS > 758-16-7 N,N-Dimethylthioformamide
758-16-7 N,N-Dimethylthioformamide
| Produkt-Name |
N,N-Dimethylthioformamide |
| Synonyme |
NN-Dimethylthioformamide |
| Molekulare Formel |
C3H7NS |
| Molecular Weight |
89.1594 |
| InChI |
InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
| CAS Registry Number |
758-16-7 |
| EINECS |
212-060-7 |
| Molecular Structure |
|
| Dichte |
0.985g/cm3 |
| Siedepunkt |
224.9°C at 760 mmHg |
| Brechungsindex |
1.511 |
| Flammpunkt |
89.8°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
