ChemNet > CAS > 83902-00-5 2-ethyl-1H-imidazole-5-carbaldehyde
83902-00-5 2-ethyl-1H-imidazole-5-carbaldehyde
| Produkt-Name |
2-ethyl-1H-imidazole-5-carbaldehyde |
| Synonyme |
2-Ethyl-4-Formylimidazole |
| Molekulare Formel |
C6H8N2O |
| Molecular Weight |
124.1405 |
| InChI |
InChI=1/C6H8N2O/c1-2-6-7-3-5(4-9)8-6/h3-4H,2H2,1H3,(H,7,8) |
| CAS Registry Number |
83902-00-5 |
| Molecular Structure |
|
| Dichte |
1.177g/cm3 |
| Siedepunkt |
355.3°C at 760 mmHg |
| Brechungsindex |
1.579 |
| Flammpunkt |
172.6°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
