ChemNet > CAS > 881-03-8 2-Methyl-1-nitronaphthalene
881-03-8 2-Methyl-1-nitronaphthalene
| Produkt-Name |
2-Methyl-1-nitronaphthalene |
| Synonyme |
Naphthalene, 2-methyl-1-nitro-; 1-Nitro-2-methylnaphthalene; 4-05-00-01698 (Beilstein Handbook Reference); BRN 1954310; CCRIS 4680; NSC 7516 |
| Molekulare Formel |
C11H9NO2 |
| Molecular Weight |
187.1947 |
| InChI |
InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| CAS Registry Number |
881-03-8 |
| EINECS |
212-917-5 |
| Molecular Structure |
|
| Dichte |
1.234g/cm3 |
| Schmelzpunkt |
79-82℃ |
| Siedepunkt |
320.5°C at 760 mmHg |
| Brechungsindex |
1.652 |
| Flammpunkt |
150.4°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
